[1-(benzenesulfonyl)indol-2-yl]-[2-(hydroxymethyl)-5-nitrophenyl]methanone structure
|
Common Name | [1-(benzenesulfonyl)indol-2-yl]-[2-(hydroxymethyl)-5-nitrophenyl]methanone | ||
|---|---|---|---|---|
| CAS Number | 88207-11-8 | Molecular Weight | 436.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(benzenesulfonyl)indol-2-yl]-[2-(hydroxymethyl)-5-nitrophenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H16N2O6S |
|---|---|
| Molecular Weight | 436.43700 |
| Exact Mass | 436.07300 |
| PSA | 130.57000 |
| LogP | 5.11380 |
| InChIKey | IOEFKJSFEBYLAN-UHFFFAOYSA-N |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1CO)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 |
|
~%
[1-(benzenesulf... CAS#:88207-11-8 |
| Literature: Ashcroft, William R.; Dalton, Lesley; Beal, Michael G.; Humphrey, Godfred L.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2409 - 2412 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-hydroxymethyl-5-nitrophenyl 1-phenylsulphonylindol-2-yl ketone |