3-chloro-1-(4-methylphenyl)sulfonyl-2-phenylindole structure
|
Common Name | 3-chloro-1-(4-methylphenyl)sulfonyl-2-phenylindole | ||
|---|---|---|---|---|
| CAS Number | 88207-51-6 | Molecular Weight | 381.87500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-1-(4-methylphenyl)sulfonyl-2-phenylindole |
|---|
| Molecular Formula | C21H16ClNO2S |
|---|---|
| Molecular Weight | 381.87500 |
| Exact Mass | 381.05900 |
| PSA | 47.45000 |
| LogP | 6.58790 |
| InChIKey | RZGUVHZYGYHUSA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccccc3)c(Cl)c3ccccc32)cc1 |
|
~84%
3-chloro-1-(4-m... CAS#:88207-51-6 |
| Literature: Shen, Zengming; Lu, Xiyan Advanced Synthesis and Catalysis, 2009 , vol. 351, # 18 p. 3107 - 3112 |
|
~%
3-chloro-1-(4-m... CAS#:88207-51-6 |
| Literature: Dalton, Lesley; Humphrey, Godfred L.; Cooper, Melanie M.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2417 - 2422 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |