2-nitro-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 2-nitro-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 88210-30-4 | Molecular Weight | 288.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitro-4-[(4-nitrophenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8N4O5 |
|---|---|
| Molecular Weight | 288.21600 |
| Exact Mass | 288.04900 |
| PSA | 133.10000 |
| LogP | 2.78160 |
| InChIKey | BAWPTBACBDHBOR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=Nc2ccc(O)c([N+](=O)[O-])c2)cc1 |
|
~%
2-nitro-4-[(4-n... CAS#:88210-30-4 |
| Literature: Hewitt; Mitchell Journal of the Chemical Society, 1905 , vol. 87, p. 231 |
|
~%
2-nitro-4-[(4-n... CAS#:88210-30-4 |
| Literature: Hewitt; Mitchell Journal of the Chemical Society, 1905 , vol. 87, p. 231 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3.4'-Dinitro-4-oxy-azobenzol |
| 3,4'-dinitro-4-hydroxyazobenzene |