H-Val-Oall.TosOH structure
|
Common Name | H-Val-Oall.TosOH | ||
|---|---|---|---|---|
| CAS Number | 88224-02-6 | Molecular Weight | 329.41200 | |
| Density | N/A | Boiling Point | 200.1ºC at 760 mmHg | |
| Molecular Formula | C15H23NO5S | Melting Point | 117-120ºC | |
| MSDS | USA | Flash Point | 70.7ºC | |
Use of H-Val-Oall.TosOHL-Valine allyl ester p-toluenesulfonate salt is a valine derivative[1]. |
| Name | 4-methylbenzenesulfonic acid,prop-2-enyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | L-Valine allyl ester p-toluenesulfonate salt is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 200.1ºC at 760 mmHg |
|---|---|
| Melting Point | 117-120ºC |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.41200 |
| Flash Point | 70.7ºC |
| Exact Mass | 329.13000 |
| PSA | 115.07000 |
| LogP | 3.72170 |
| InChIKey | HSIRKDASFUCGOZ-FJXQXJEOSA-N |
| SMILES | C=CCOC(=O)C(N)C(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~88%
H-Val-Oall.TosOH CAS#:88224-02-6 |
| Literature: Goode, David R.; Sharma, Anil K.; Hergenrother, Paul J. Organic Letters, 2005 , vol. 7, # 16 p. 3529 - 3532 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
H. Waldmann, H. Kunz
Liebigs Ann. Chem. , 1712, (1983)
|
| L-valine allyl ester p-tosylate |
| L-valine benzylester |
| D,L-Val-OBn |
| D,L-Valine Benzyl Ester |
| L-valine (phenylmethyl)ester |
| Valine Phenylmethyl Ester |
| H-Val-Oall.TosOH |
| (S)-2-amino-3-methyl butanoic acid benzyl ester |
| L-Valin-allylester-hydro-p-toluolsulfonat |
| DL-Valin-benzylester |
| L-valine allyl ester p-toluenesulfonate |