4-Carboxytolbutamide Methyl Ester structure
|
Common Name | 4-Carboxytolbutamide Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 88241-94-5 | Molecular Weight | 314.35700 | |
| Density | 1.258g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(butylcarbamoylsulfamoyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.35700 |
| Exact Mass | 314.09400 |
| PSA | 109.95000 |
| LogP | 3.12380 |
| Index of Refraction | 1.53 |
| InChIKey | ZLNXHCAHLBRDBT-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C(=O)OC)cc1 |
| HS Code | 2935009090 |
|---|
|
~64%
4-Carboxytolbut... CAS#:88241-94-5 |
| Literature: Makaya; Irie; Shibasaki Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 7 p. 2518 - 2519 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzoic acid,4-[[[(butylamino)carbonyl]amino]sulfonyl]-,methyl ester |
| METHYL 4-BUTYLAMINOCARBONYLAMINOSULFONYLBENZOATE |