octyl 1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate structure
|
Common Name | octyl 1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 88280-81-3 | Molecular Weight | 268.30900 | |
| Density | 1.137g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | octyl 2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.30900 |
| Exact Mass | 268.14200 |
| PSA | 92.54000 |
| LogP | 2.40510 |
| Index of Refraction | 1.491 |
| InChIKey | JVCVWBZTXWYZSC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~%
octyl 1,2,3,6-t... CAS#:88280-81-3 |
| Literature: Falk; Lucke Pharmazie, 1989 , vol. 44, # 9 p. 647 - 647 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 289-399-2 |
| Octyl 1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylate |
| 4-Pyrimidinecarboxylicacid,1,2,3,6-tetrahydro-2,6-dioxo-,octyl ester |
| Orotsaeureoctylester |