2-BENZYLOXY-1-METHYLPYRIDINIUM TRIFLUOROMETHANESULFONATE structure
|
Common Name | 2-BENZYLOXY-1-METHYLPYRIDINIUM TRIFLUOROMETHANESULFONATE | ||
|---|---|---|---|---|
| CAS Number | 882980-43-0 | Molecular Weight | 349.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14F3NO4S | Melting Point | 85-91ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 1-methyl-2-phenylmethoxypyridin-1-ium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 85-91ºC |
|---|---|
| Molecular Formula | C14H14F3NO4S |
| Molecular Weight | 349.32500 |
| Exact Mass | 349.06000 |
| PSA | 78.69000 |
| LogP | 3.22230 |
| InChIKey | DUXHYQYOPHEFGC-UHFFFAOYSA-M |
| SMILES | C[n+]1ccccc1OCc1ccccc1.O=S(=O)([O-])C(F)(F)F |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
|
Mix-and-heat benzylation of alcohols using a bench-stable pyridinium salt.
J. Org. Chem. 71 , 3923, (2006) 2-Benzyloxy-1-methylpyridinium triflate (1) is a stable, neutral organic salt that converts alcohols into benzyl ethers upon warming. The synthesis and reactivity of 1 are described herein. Benzylatio... |
|
|
Synthesis of benzyl esters using 2-benzyloxy-1-methylpyridinium triflate.
J. Org. Chem. 72 , 8962, (2007) Triethylamine (Et3N) mediates esterification reactions between the title reagent (1) and carboxylic acids. Alcohols, phenols, amides, and other sensitive functionality are not affected; a dual role fo... |
|
|
Dudley, G. B. et al.
Synlett , 3142, (2005)
|
| 2-Benzyloxy-1-methylpyridinium triflate,trifluoromethanesulfonate |
| Dudley Reagent |
| Bn-OPT |
| 2-Benzyloxy-1-methylpyridinium Trifluoromethanesulfonate |