3-(2-Oxobenzo[d]thiazol-3(2H)-yl)propanoic acid structure
|
Common Name | 3-(2-Oxobenzo[d]thiazol-3(2H)-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 883-50-1 | Molecular Weight | 223.24800 | |
| Density | 1.447g/cm3 | Boiling Point | 452.9ºC at 760 mmHg | |
| Molecular Formula | C10H9NO3S | Melting Point | 102-104ºC | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 3-(2-oxo-1,3-benzothiazol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760 mmHg |
| Melting Point | 102-104ºC |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.24800 |
| Flash Point | 227.7ºC |
| Exact Mass | 223.03000 |
| PSA | 87.54000 |
| LogP | 1.53770 |
| Index of Refraction | 1.654 |
| InChIKey | MNJIHLQXWFMJRV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCn1c(=O)sc2ccccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| HS Code | 2934200090 |
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-<2-Oxo-benzo<d>thiazol-3-yl>-propionsaeure |