6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride
Modify Date: 2025-08-25 16:53:53
6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride structure
|
Common Name | 6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 883-87-4 | Molecular Weight | 243.73000 | |
| Density | N/A | Boiling Point | 313.4ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO2 | Melting Point | 189-192ºC | |
| MSDS | N/A | Flash Point | 127.1ºC | |
| Name | (1S)-6,7-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 313.4ºC at 760 mmHg |
|---|---|
| Melting Point | 189-192ºC |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73000 |
| Flash Point | 127.1ºC |
| Exact Mass | 243.10300 |
| PSA | 30.49000 |
| LogP | 3.04130 |
| InChIKey | UJXLTDHDLUBZBL-QRPNPIFTSA-N |
| SMILES | COc1cc2c(cc1OC)C(C)NCC2.Cl |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 37/39-26 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of human placental Monoamine oxidase A (competitive inhibition was observe...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL733874
|
|
Name: Inhibition of human placental Monoamine oxidase B; No inhibition at a concentration o...
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL732533
|
Total 2, Current Page 1 of 1
1
| einecs 212-934-8 |