6-nitropyrido[2,1-b]quinazolin-11-one
![6-nitropyrido[2,1-b]quinazolin-11-one Structure](https://image.chemsrc.com/caspic/214/88369-60-2.png)
6-nitropyrido[2,1-b]quinazolin-11-one structure
|
Common Name | 6-nitropyrido[2,1-b]quinazolin-11-one | ||
|---|---|---|---|---|
| CAS Number | 88369-60-2 | Molecular Weight | 241.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-nitropyrido[2,1-b]quinazolin-11-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7N3O3 |
|---|---|
| Molecular Weight | 241.20200 |
| Exact Mass | 241.04900 |
| PSA | 80.19000 |
| LogP | 2.27910 |
| InChIKey | WUJOBXVFJYXGMC-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nc2c([N+](=O)[O-])cccn12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![methyl 2-[(3-nitropyridin-2-yl)amino]benzoate structure](https://image.chemsrc.com/caspic/193/88369-56-6.png)
![2-[(3-nitropyridin-2-yl)amino]benzamide structure](https://image.chemsrc.com/caspic/117/88369-58-8.png)
![ethyl 2-[(3-nitropyridin-2-yl)amino]benzoate structure](https://image.chemsrc.com/caspic/155/88369-57-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-nitro-11H-pyrido<2,1-b>quinazolin-11-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 88369-60-2? |
| A: Chinese name of 88369-60-2 is 88369-60-2. |
| Q: What is the English name of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: The English name of 6-nitropyrido[2,1-b]quinazolin-11-one is 6-nitropyrido[2,1-b]quinazolin-11-one. |
| Q: What is the polar surface area (PSA) of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: Polar surface area (PSA) of 6-nitropyrido[2,1-b]quinazolin-11-one is 80.19000. |
| Q: What is the InChIKey of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: InChIKey of 6-nitropyrido[2,1-b]quinazolin-11-one is WUJOBXVFJYXGMC-UHFFFAOYSA-N. |
| Q: What English synonyms does 6-nitropyrido[2,1-b]quinazolin-11-one have? |
| A: English synonyms of 6-nitropyrido[2,1-b]quinazolin-11-one: 6-nitro-11H-pyridoquinazolin-11-one. |
| Q: What is the CAS number of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: CAS number of 6-nitropyrido[2,1-b]quinazolin-11-one is 88369-60-2. |
| Q: What is the SMILES notation of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: SMILES notation of 6-nitropyrido[2,1-b]quinazolin-11-one is O=c1c2ccccc2nc2c([N+](=O)[O-])cccn12. |
| Q: What is the molecular formula of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: Molecular formula of 6-nitropyrido[2,1-b]quinazolin-11-one is C12H7N3O3. |
| Q: What are the upstream materials of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: Related upstream materials(CAS) of 6-nitropyrido[2,1-b]quinazolin-11-one: 88369-56-6;5470-18-8;88369-58-8;88369-57-7;28144-70-9;134-20-3;87-25-2. |
| Q: What is the LogP of 6-nitropyrido[2,1-b]quinazolin-11-one? |
| A: LogP of 6-nitropyrido[2,1-b]quinazolin-11-one is 2.27910. |