4-(4-methylphenoxymethyl)benzoic acid
Modify Date: 2025-09-16 11:01:09
4-(4-methylphenoxymethyl)benzoic acid structure
|
Common Name | 4-(4-methylphenoxymethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 88382-46-1 | Molecular Weight | 242.27000 | |
| Density | 1.193g/cm3 | Boiling Point | 417.1ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
| Name | 4-[(4-methylphenoxy)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 417.1ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 157.7ºC |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 3.27220 |
| Index of Refraction | 1.597 |
| InChIKey | YYFXDSVQJCNVML-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-(4-methylphen... CAS#:88382-46-1 |
| Literature: Am. Cyanamid Co. Patent: US2375138 , 1942 ; |
|
~%
4-(4-methylphen... CAS#:88382-46-1 |
| Literature: Am. Cyanamid Co. Patent: US2375138 , 1942 ; |
|
~%
4-(4-methylphen... CAS#:88382-46-1 |
| Literature: Am. Cyanamid Co. Patent: US2375138 , 1942 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-p-Tolyloxymethyl-benzoic acid |
| 4-p-Tolyloxymethyl-benzoesaeure |