triethyl-(2-methoxy-2-oxoethyl)azanium,bromide structure
|
Common Name | triethyl-(2-methoxy-2-oxoethyl)azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 88390-02-7 | Molecular Weight | 254.16500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethyl-(2-methoxy-2-oxoethyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H20BrNO2 |
|---|---|
| Molecular Weight | 254.16500 |
| Exact Mass | 253.06800 |
| PSA | 26.30000 |
| InChIKey | OVIJAQFQVZMDIV-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC(=O)OC.[Br-] |
|
~%
triethyl-(2-met... CAS#:88390-02-7 |
| Literature: Renshaw; McGreal Journal of the American Chemical Society, 1932 , vol. 54, p. 1471,1473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethanaminium,N,N,N-triethyl-2-methoxy-2-oxo-,bromide |
| Triaethyl-methoxycarbonylmethyl-ammonium,Bromid |
| triethyl-methoxycarbonylmethyl-ammonium,bromide |