ethyl 3-(1,4,4-trimethyl-2-oxocyclopentyl)prop-2-enoate structure
|
Common Name | ethyl 3-(1,4,4-trimethyl-2-oxocyclopentyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 88400-72-0 | Molecular Weight | 224.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(1,4,4-trimethyl-2-oxocyclopentyl)prop-2-enoate |
|---|
| Molecular Formula | C13H20O3 |
|---|---|
| Molecular Weight | 224.29600 |
| Exact Mass | 224.14100 |
| PSA | 43.37000 |
| LogP | 2.50110 |
| InChIKey | LMEZLESFGHFIJJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=CC1(C)CC(C)(C)CC1=O |
|
~63%
ethyl 3-(1,4,4-... CAS#:88400-72-0 |
| Literature: Janardhanam, Selvasekaran; Balakumar, Arumugham; Rajagopalan, Krishnamoorthy Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 5 p. 551 - 556 |
|
~%
ethyl 3-(1,4,4-... CAS#:88400-72-0 |
| Literature: Eaton, Penelope J.; Jogia, Madhu K.; O'Connor, Anthony W.; Weavers, Rex T. Australian Journal of Chemistry, 1983 , vol. 36, # 7 p. 1399 - 1407 |