Ethyl 2-(triphenylphosphoranylidene)acetate structure
|
Common Name | Ethyl 2-(triphenylphosphoranylidene)acetate | ||
|---|---|---|---|---|
| CAS Number | 1099-45-2 | Molecular Weight | 348.375 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 490.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C22H21O2P | Melting Point | 128-131 °C | |
| MSDS | Chinese USA | Flash Point | 263.5±44.3 °C | |
| Name | (Carbethoxymethylene)triphenylphosphorane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 490.4±28.0 °C at 760 mmHg |
| Melting Point | 128-131 °C |
| Molecular Formula | C22H21O2P |
| Molecular Weight | 348.375 |
| Flash Point | 263.5±44.3 °C |
| Exact Mass | 348.127930 |
| PSA | 36.11000 |
| LogP | 4.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | IIHPVYJPDKJYOU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| Water Solubility | Insoluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S22-S24/25-S45-S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29310095 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ethyl (triphenyl-λ-phosphanylidene)acetate |
| (Triphenylphosphoranylidene)acetic Acid Ethyl Ester |
| Carboethoxymethylidenetriphenylphosphorane |
| EINECS 214-151-7 |
| Acetic acid, (triphenylphosphoranylidene)-, ethyl ester |
| Triphenylcarbethoxymethylenephosphorane |
| MFCD00009183 |
| (Triphenylphosphoranylidene)acetic |
| ethyl 2-(triphenyl-λ<sup>5</sup>-phosphanylidene)acetate |
| ((Ethoxycarbonyl)methylene)triphenylphosphorane |
| Carbethoxymethylidenetriphenylphosphorane |
| (Ethoxycarbonylmethylene)triphenylphosphorane |
| Phosphorane, (carboxymethylene)triphenyl-, ethyl ester |
| Acetic acid, 2-(triphenylphosphoranylidene)-, ethyl ester |
| Ethyl (triphenylphosphoranylidene)acetate |
| Ethyl 2-(triphenylphosphoranylidene)acetate |
| [(Ethoxycarbonyl)methylene]triphenylphosphorane |