CHEMBRDG-BB 7398969
Modify Date: 2024-01-31 18:05:13
CHEMBRDG-BB 7398969 structure
|
Common Name | CHEMBRDG-BB 7398969 | ||
|---|---|---|---|---|
| CAS Number | 884091-24-1 | Molecular Weight | 204.26500 | |
| Density | 1.117g/cm3 | Boiling Point | 328.3ºC at 760 mmHg | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.2ºC | |
| Name | 2,2-dimethyl-1-(4-methylphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 328.3ºC at 760 mmHg |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26500 |
| Flash Point | 155.2ºC |
| Exact Mass | 204.11500 |
| PSA | 37.30000 |
| LogP | 2.74730 |
| Index of Refraction | 1.552 |
| InChIKey | SSLIEVKLCVTOOJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2(C(=O)O)CC2(C)C)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2-difluoropropionitrile |