{4-[(4-Methylperhydro-1,4-diazepin-1-yl)methyl]phenyl}methanol structure
|
Common Name | {4-[(4-Methylperhydro-1,4-diazepin-1-yl)methyl]phenyl}methanol | ||
|---|---|---|---|---|
| CAS Number | 884507-50-0 | Molecular Weight | 234.33700 | |
| Density | 1.072g/cm3 | Boiling Point | 190ºC | |
| Molecular Formula | C14H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | [4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]methanol |
|---|
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 190ºC |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.33700 |
| Flash Point | 165.7ºC |
| Exact Mass | 234.17300 |
| PSA | 26.71000 |
| LogP | 1.19220 |
| Index of Refraction | 1.558 |
| InChIKey | YQUWAYPNHCWYNU-UHFFFAOYSA-N |
| SMILES | CN1CCCN(Cc2ccc(CO)cc2)CC1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |