4,4'-Dibromo-4''-phenyltriphenylamine structure
|
Common Name | 4,4'-Dibromo-4''-phenyltriphenylamine | ||
|---|---|---|---|---|
| CAS Number | 884530-69-2 | Molecular Weight | 479.207 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 573.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H17Br2N | Melting Point | 136.0-140.0 °C | |
| MSDS | N/A | Flash Point | 300.7±28.7 °C | |
| Name | 4,4'-Dibromo-4''-phenyltriphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.6±45.0 °C at 760 mmHg |
| Melting Point | 136.0-140.0 °C |
| Molecular Formula | C24H17Br2N |
| Molecular Weight | 479.207 |
| Flash Point | 300.7±28.7 °C |
| Exact Mass | 476.972748 |
| PSA | 3.24000 |
| LogP | 9.52 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | BKJULDLPGWGCHY-UHFFFAOYSA-N |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2921499090 |
|
~10%
4,4'-Dibromo-4'... CAS#:884530-69-2 |
| Literature: SEMICONDUCTOR ENERGY LABORATORY CO., LTD. Patent: WO2009/139358 A1, 2009 ; Location in patent: Page/Page column 84 ; |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N-bis(4-bromophenyl)-4-phenylaniline |
| N,N-Bis(4-bromophenyl)-4-biphenylamine |
| N-[1,1'-Biphenyl]-4-yl-4-bromo-N-(4-bromophenyl)benzenamine |