1,4-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione
Modify Date: 2026-07-23 13:17:48
![1,4-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione Structure](https://image.chemsrc.com/caspic/036/88476-76-0.png)
1,4-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione structure
|
Common Name | 1,4-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 88476-76-0 | Molecular Weight | 438.55900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis[2-(diethylamino)ethoxy]anthracene-9,10-dione |
|---|
| Molecular Formula | C26H34N2O4 |
|---|---|
| Molecular Weight | 438.55900 |
| Exact Mass | 438.25200 |
| PSA | 59.08000 |
| LogP | 3.90320 |
| InChIKey | WNOAZUFOZKQFQU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(OCCN(CC)CC)c2c1C(=O)c1ccccc1C2=O |
|
~%
1,4-bis[2-(diet... CAS#:88476-76-0 |
| Literature: Sill; Andrews; Sweet; Hoffman; Tiernan; Grisar; Fleming; Mayer Journal of Medicinal Chemistry, 1974 , vol. 17, # 9 p. 965 - 968 |
|
~%
1,4-bis[2-(diet... CAS#:88476-76-0 |
| Literature: Wenner Justus Liebigs Annalen der Chemie, 1957 , vol. 607, p. 121,124 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: DNA binding dissociation constant as KD; No data
Source: ChEMBL
Target: Nucleic Acid
External Id: CHEMBL635339
|
Total 1, Current Page 1 of 1
1