Larsucosterol structure
|
Common Name | Larsucosterol | ||
|---|---|---|---|---|
| CAS Number | 884905-07-1 | Molecular Weight | 482.72 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C27H46O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LarsucosterolLarsucosterol is a cholesterol metabolite from the nuclei of normal human liver tissues, epigenetically regulates the transcription of proteins and enzymes involved in lipid synthesis, inflammation, and apoptosis[1][2]. |
| Name | (3β)-25-Hydroxycholest-5-en-3-yl hydrogen sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Larsucosterol is a cholesterol metabolite from the nuclei of normal human liver tissues, epigenetically regulates the transcription of proteins and enzymes involved in lipid synthesis, inflammation, and apoptosis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C27H46O5S |
| Molecular Weight | 482.72 |
| Exact Mass | 482.306610 |
| LogP | 7.95 |
| Index of Refraction | 1.552 |
| InChIKey | PIUZYOCNZPYXOA-ZHHJOTBYSA-N |
| SMILES | CC(CCCC(C)(C)O)C1CCC2C3CC=C4CC(OS(=O)(=O)O)CCC4(C)C3CCC12C |
| Storage condition | -20°C |
| (3β)-25-Hydroxycholest-5-en-3-yl hydrogen sulfate |
| Cholest-5-ene-3,25-diol, 3-(hydrogen sulfate), (3β)- |