2-methylbenzo[e]isoindole-1,3-dione structure
|
Common Name | 2-methylbenzo[e]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 885-07-4 | Molecular Weight | 211.21600 | |
| Density | 1.348g/cm3 | Boiling Point | 376.2ºC at 760 mmHg | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1ºC | |
| Name | 2-methylbenzo[e]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760 mmHg |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.21600 |
| Flash Point | 178.1ºC |
| Exact Mass | 211.06300 |
| PSA | 37.38000 |
| LogP | 2.00350 |
| Index of Refraction | 1.694 |
| InChIKey | JVTIUKODBFHDLP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccc3ccccc3c2C1=O |
|
~%
2-methylbenzo[e... CAS#:885-07-4 |
| Literature: Bayer Corporation Patent: US6015458 A1, 2000 ; |
|
~71%
2-methylbenzo[e... CAS#:885-07-4 |
| Literature: Mizuno, Masahiro; Yamano, Mitsuhisa Heterocycles, 2006 , vol. 67, # 2 p. 807 - 814 |
|
~71%
2-methylbenzo[e... CAS#:885-07-4 |
| Literature: Wintgens, Veronique; Valat, Pierre; Kossanyi, Jean; Biczok, Laszlo; Demeter, Attila; Berces, Tibor Journal of the Chemical Society, Faraday Transactions, 1994 , vol. 90, # 3 p. 411 - 422 |
| N-Methyl-naphthalin-1,2-dicarbonsaeure-imid |
| N-methyl-1,2-naphthalenedicarboximide |
| N-methylnaphthalene-1,2-dicarboximide |
| 2-methyl-benzo[e]isoindole-1,3-dione |
| N-Methyl-benz<g>dihydro-isoindol-1,3-dion |
| 2-methyl-1H-benzo[e]isoindole-1,3(2H)-dione |
| N-methyl-1,2-naphthalimide |
| N-Methylnaphthalimide |