methyl 2,2-dimethyl-3-(phenylmethoxyamino)propanoate structure
|
Common Name | methyl 2,2-dimethyl-3-(phenylmethoxyamino)propanoate | ||
|---|---|---|---|---|
| CAS Number | 88517-39-9 | Molecular Weight | 237.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,2-dimethyl-3-(phenylmethoxyamino)propanoate |
|---|
| Molecular Formula | C13H19NO3 |
|---|---|
| Molecular Weight | 237.29500 |
| Exact Mass | 237.13600 |
| PSA | 47.56000 |
| LogP | 2.29790 |
| InChIKey | OQGBZQRCLHLANI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)CNOCc1ccccc1 |
|
~89%
methyl 2,2-dime... CAS#:88517-39-9 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
|
~%
methyl 2,2-dime... CAS#:88517-39-9 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |