methyl 2,2-dimethyl-3-(phenylmethoxyamino)butanoate structure
|
Common Name | methyl 2,2-dimethyl-3-(phenylmethoxyamino)butanoate | ||
|---|---|---|---|---|
| CAS Number | 88517-46-8 | Molecular Weight | 251.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2,2-dimethyl-3-(phenylmethoxyamino)butanoate |
|---|
| Molecular Formula | C14H21NO3 |
|---|---|
| Molecular Weight | 251.32100 |
| Exact Mass | 251.15200 |
| PSA | 47.56000 |
| LogP | 2.68640 |
| InChIKey | MYEMCIOFQKHGHP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)C(C)NOCc1ccccc1 |
|
~53%
methyl 2,2-dime... CAS#:88517-46-8 |
| Literature: Ikeda, Kiyoshi; Achiwa, Kazuo; Sekiya, Minoru Tetrahedron Letters, 1983 , vol. 24, # 43 p. 4707 - 4710 |
|
~50%
methyl 2,2-dime... CAS#:88517-46-8 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
|
~%
methyl 2,2-dime... CAS#:88517-46-8 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
|
~%
methyl 2,2-dime... CAS#:88517-46-8 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |