1,5-dichloro-2-[(2,4-dichloro-5-methylphenyl)disulfanyl]-4-methylbenzene structure
|
Common Name | 1,5-dichloro-2-[(2,4-dichloro-5-methylphenyl)disulfanyl]-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 88519-69-1 | Molecular Weight | 384.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dichloro-2-[(2,4-dichloro-5-methylphenyl)disulfanyl]-4-methylbenzene |
|---|
| Molecular Formula | C14H10Cl4S2 |
|---|---|
| Molecular Weight | 384.17100 |
| Exact Mass | 381.89800 |
| PSA | 50.60000 |
| LogP | 7.71640 |
| InChIKey | PJXJVCCMXWQPIM-UHFFFAOYSA-N |
| SMILES | Cc1cc(SSc2cc(C)c(Cl)cc2Cl)c(Cl)cc1Cl |
|
~93%
1,5-dichloro-2-... CAS#:88519-69-1 |
| Literature: Bauer, Wolfgang Phosphorus, Sulfur and Silicon and the Related Elements, 1994 , vol. 96, # 1-4 p. 493 - 494 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |