Tert-butyl indolin-5-yl-carbamate structure
|
Common Name | Tert-butyl indolin-5-yl-carbamate | ||
|---|---|---|---|---|
| CAS Number | 885270-06-4 | Molecular Weight | 234.294 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 324.7±31.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.2±24.8 °C | |
| Name | tert-butyl N-(2,3-dihydro-1H-indol-5-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.7±31.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.294 |
| Flash Point | 150.2±24.8 °C |
| Exact Mass | 234.136826 |
| PSA | 50.36000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | PCEAUMPCFBPXKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(c1)CCN2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid,(2,3-dihydro-1H-indol-5-yl)-,1,1-dimethylethyl ester (9CI) |
| Carbamic acid, N-(2,3-dihydro-1H-indol-5-yl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 2,3-dihydro-1H-indol-5-ylcarbamate |
| tert-Butyl indolin-5-ylcarbamate |
| (2,3-DIHYDRO-1H-INDOL-5-YL)-CARBAMIC ACID TERT-BUTYL ESTER |