5-(Benzyloxy)-1H-indazole-3-carbaldehyde structure
|
Common Name | 5-(Benzyloxy)-1H-indazole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 885271-28-3 | Molecular Weight | 252.268 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 485.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7±24.6 °C | |
| Name | 5-phenylmethoxy-2H-indazole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.9±30.0 °C at 760 mmHg |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.268 |
| Flash Point | 247.7±24.6 °C |
| Exact Mass | 252.089874 |
| PSA | 54.98000 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | LSVWVZRXSDJJFU-UHFFFAOYSA-N |
| SMILES | O=Cc1[nH]nc2ccc(OCc3ccccc3)cc12 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Benzyloxy-1H-indazole-3-carboxaldehyde |
| 1H-Indazole-3-carboxaldehyde, 5-(phenylmethoxy)- |
| 5-(Benzyloxy)-1H-indazole-3-carbaldehyde |