Methyl 3-bromo-2-methyl-5-nitrobenzoate structure
|
Common Name | Methyl 3-bromo-2-methyl-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 885519-05-1 | Molecular Weight | 274.068 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 344.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3±26.5 °C | |
| Name | Methyl 3-bromo-2-methyl-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.8±37.0 °C at 760 mmHg |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.068 |
| Flash Point | 162.3±26.5 °C |
| Exact Mass | 272.963654 |
| PSA | 72.12000 |
| LogP | 2.76 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | KHYSOGYKNCNXIS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc(Br)c1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~%
Methyl 3-bromo-... CAS#:885519-05-1 |
| Literature: ABBOTT LABORATORIES Patent: WO2004/108672 A1, 2004 ; Location in patent: Page 63; 64 ; WO 2004/108672 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Bromo-2-methyl-5-nitromethyl benzoate |
| Methyl 3-bromo-2-methyl-5-nitrobenzoate |
| Benzoic acid, 3-bromo-2-methyl-5-nitro-, methyl ester |
| methyl3-bromo-2-methyl-5-nitrobenzoate |