Methyl 4-chloro-1H-indazole-6-carboxylate structure
|
Common Name | Methyl 4-chloro-1H-indazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885519-19-7 | Molecular Weight | 210.617 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 385.8±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.1±22.3 °C | |
| Name | Methyl 4-chloro-1H-indazole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.8±22.0 °C at 760 mmHg |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.617 |
| Flash Point | 187.1±22.3 °C |
| Exact Mass | 210.019608 |
| PSA | 54.98000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | BRRIKQXUDWIOIL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c2cn[nH]c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chloro-6-indazolecarboxylic acid methyl ester |
| 1H-Indazole-6-carboxylic acid, 4-chloro-, methyl ester |
| QC-2859 |
| 4-Chloro-1H-indazole-6-carboxylic acid methyl ester |
| Methyl 4-chloro-1H-indazole-6-carboxylate |