benzyl N-(2-piperidin-1-yl-2-sulfanylideneethyl)carbamate structure
|
Common Name | benzyl N-(2-piperidin-1-yl-2-sulfanylideneethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 88621-49-2 | Molecular Weight | 292.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl N-(2-piperidin-1-yl-2-sulfanylideneethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20N2O2S |
|---|---|
| Molecular Weight | 292.39700 |
| Exact Mass | 292.12500 |
| PSA | 77.15000 |
| LogP | 2.86840 |
| InChIKey | WVSRWFTUFORUNV-UHFFFAOYSA-N |
| SMILES | O=C(NCC(=S)N1CCCCC1)OCc1ccccc1 |
|
~87%
benzyl N-(2-pip... CAS#:88621-49-2 |
| Literature: Clausen, Kim; Thorsen, Michael; Lawesson, Sven-Olov; Spatola, Arno F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 4 p. 785 - 798 |
|
~%
benzyl N-(2-pip... CAS#:88621-49-2 |
| Literature: Clausen, Kim; Thorsen, Michael; Lawesson, Sven-Olov; Spatola, Arno F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 4 p. 785 - 798 |
|
~%
benzyl N-(2-pip... CAS#:88621-49-2 |
| Literature: Clausen, Kim; Thorsen, Michael; Lawesson, Sven-Olov; Spatola, Arno F. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 4 p. 785 - 798 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Carbamic acid,[2-(1-piperidinyl)-2-thioxoethyl]-,phenylmethyl ester |