(3-oxo-1,3-diphenylprop-1-enyl) diphenyl phosphate
Modify Date: 2025-09-18 20:22:33
(3-oxo-1,3-diphenylprop-1-enyl) diphenyl phosphate structure
|
Common Name | (3-oxo-1,3-diphenylprop-1-enyl) diphenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 88626-00-0 | Molecular Weight | 456.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H21O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-oxo-1,3-diphenylprop-1-enyl) diphenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H21O5P |
|---|---|
| Molecular Weight | 456.42600 |
| Exact Mass | 456.11300 |
| PSA | 71.64000 |
| LogP | 7.19310 |
| InChIKey | IJLLJSZCOBYBLI-UHFFFAOYSA-N |
| SMILES | O=C(C=C(OP(=O)(Oc1ccccc1)Oc1ccccc1)c1ccccc1)c1ccccc1 |
|
~%
(3-oxo-1,3-diph... CAS#:88626-00-0 |
| Literature: Nakagawa,M. et al. Bulletin of the Chemical Society of Japan, 1962 , vol. 35, p. 1485 - 1487 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphorsaeure-diphenyl-(1,3-diphenyl-3-oxo-prop-1-enyl)-ester |
| (3-Oxo-1,3-diphenyl-prop-1-enyl)-diphenyl-phosphat |
| Diphenyl-<1,3-diphenyl-2-propen-1-on-3-yl>-phosphat |
| Phosphoric acid,3-oxo-1,3-diphenyl-1-propenyl diphenyl ester |