3-(1'-Aminoethyl)-1-N-Boc-aniline structure
|
Common Name | 3-(1'-Aminoethyl)-1-N-Boc-aniline | ||
|---|---|---|---|---|
| CAS Number | 886362-19-2 | Molecular Weight | 236.31000 | |
| Density | 1.095g/cm3 | Boiling Point | 303.6ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.4ºC | |
| Name | tert-Butyl N-[3-(1-aminoethyl)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 303.6ºC at 760 mmHg |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31000 |
| Flash Point | 137.4ºC |
| Exact Mass | 236.15200 |
| PSA | 64.35000 |
| LogP | 3.82660 |
| Index of Refraction | 1.554 |
| InChIKey | IUBFAZSFGODJPA-UHFFFAOYSA-N |
| SMILES | CC(N)c1cccc(NC(=O)OC(C)(C)C)c1 |
| HS Code | 2924299090 |
|---|
|
~58%
3-(1'-Aminoethy... CAS#:886362-19-2 |
| Literature: Perron, Valerie; Abbott, Shaun; Moreau, Nancie; Lee, Devin; Penney, Christopher; Zacharie, Boulos Synthesis, 2009 , # 2 p. 283 - 289 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (RS)-3-(1-aminoethyl)-N-(tert-butoxycarbonyl)phenylamine |
| tertbutylaminoethylphenylcarbamate |
| 3-(1'-Aminoethyl)-1-N-Boc-aniline |
| tert-Butyl [3-(1-aminoethyl)phenyl]carbamate |
| N-[3-(1-Aminoethyl)Phenyl]-Carbamic Acid 1,1-Dimethylethyl Ester |