3-(aminomethyl)-1-n-boc-aniline structure
|
Common Name | 3-(aminomethyl)-1-n-boc-aniline | ||
|---|---|---|---|---|
| CAS Number | 205318-52-1 | Molecular Weight | 222.28400 | |
| Density | 1.12g/cm3 | Boiling Point | 299.5ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | 135-138ºC | |
| MSDS | USA | Flash Point | 134.9ºC | |
| Name | tert-Butyl 3-(aminomethyl)phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 299.5ºC at 760 mmHg |
| Melting Point | 135-138ºC |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 134.9ºC |
| Exact Mass | 222.13700 |
| PSA | 64.35000 |
| LogP | 3.26560 |
| Vapour Pressure | 0.00119mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | NXQNEOIMZVWHQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CN)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924299090 |
|
~%
3-(aminomethyl)... CAS#:205318-52-1 |
| Literature: WO2008/86047 A1, ; Page/Page column 83-84 ; WO 2008/086047 A1 |
|
~%
3-(aminomethyl)... CAS#:205318-52-1 |
| Literature: Synthesis, , # 2 p. 283 - 289 |
|
~%
3-(aminomethyl)... CAS#:205318-52-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 16 p. 4879 - 4883 |
|
~%
3-(aminomethyl)... CAS#:205318-52-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 16 p. 4879 - 4883 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01317790 |
| tert-butyl N-[3-(aminomethyl)phenyl]carbamate |