4,7-Dichlor-6-fluorchinolin-3-carbonitril structure
|
Common Name | 4,7-Dichlor-6-fluorchinolin-3-carbonitril | ||
|---|---|---|---|---|
| CAS Number | 886362-74-9 | Molecular Weight | 241.049 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 387.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H3Cl2FN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9±26.5 °C | |
| Name | 4,7-Dichloro-6-fluoroquinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.1±37.0 °C at 760 mmHg |
| Molecular Formula | C10H3Cl2FN2 |
| Molecular Weight | 241.049 |
| Flash Point | 187.9±26.5 °C |
| Exact Mass | 239.965729 |
| PSA | 36.68000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | OPIVJCMKKAHGNB-UHFFFAOYSA-N |
| SMILES | N#Cc1cnc2cc(Cl)c(F)cc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Dichlor-6-fluorchinolin-3-carbonitril |
| 3-Quinolinecarbonitrile, 4,7-dichloro-6-fluoro- |
| 4,7-Dichloro-6-fluoro-quinoline-3-carbonitrile |
| 4,7-Dichloro-6-fluoro-3-quinolinecarbonitrile |
| 4,7-dichloro-6-fluoroquinoline-3-carbonitrile |