3-[4-(Trifluoromethoxy)phenyl]propanoic acid structure
|
Common Name | 3-[4-(Trifluoromethoxy)phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 886499-74-7 | Molecular Weight | 234.172 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 277.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.5±25.9 °C | |
| Name | 3-[4-(trifluoromethoxy)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.3±35.0 °C at 760 mmHg |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.172 |
| Flash Point | 121.5±25.9 °C |
| Exact Mass | 234.050385 |
| PSA | 46.53000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | RRPISZJLUXOOCL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(OC(F)(F)F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
3-[4-(Trifluoro... CAS#:886499-74-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 44, # 7 p. 1085 - 1098 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid, 4-(trifluoromethoxy)- |
| 4-(Trifluoromethoxy)hydrocinnamic acid |
| 4-(Trifluoromethoxy)benzenepropanoic acid |
| 3-[4-(Trifluoromethoxy)phenyl]propionic acid |
| 3-[4-(Trifluoromethoxy)phenyl]propanoic acid |
| QV2R DOXFFF |