4-Chloro-3-(trifluoromethoxy)benzoic acid structure
|
Common Name | 4-Chloro-3-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 886500-50-1 | Molecular Weight | 240.564 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 276.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.1±25.9 °C | |
| Name | 4-Chloro-3-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.6±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4ClF3O3 |
| Molecular Weight | 240.564 |
| Flash Point | 121.1±25.9 °C |
| Exact Mass | 239.980103 |
| PSA | 46.53000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | GTBBHPFHWDVWMS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)c(OC(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
4-Chloro-3-(tri... CAS#:886500-50-1 |
| Literature: WO2014/66795 A1, ; |
|
~%
4-Chloro-3-(tri... CAS#:886500-50-1 |
| Literature: WO2014/66795 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Chloro-α,α,α-trifluoro-m-anisic acid |
| 4-Chloro-3-(trifluoromethoxy)benzoic acid |
| QVR DG COXFFF |
| JRD-1830 |
| 4-Chloro-3-trifluoromethoxy-benzoic acid |
| Benzoic acid, 4-chloro-3-(trifluoromethoxy)- |