3-Fluoro-2-(trifluoromethyl)isonicotinic acid structure
|
Common Name | 3-Fluoro-2-(trifluoromethyl)isonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 886510-09-4 | Molecular Weight | 209.098 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 322.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H3F4NO2 | Melting Point | 167-169°C | |
| MSDS | USA | Flash Point | 149.0±27.9 °C | |
| Name | 3-fluoro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.8±42.0 °C at 760 mmHg |
| Melting Point | 167-169°C |
| Molecular Formula | C7H3F4NO2 |
| Molecular Weight | 209.098 |
| Flash Point | 149.0±27.9 °C |
| Exact Mass | 209.009995 |
| PSA | 50.19000 |
| LogP | 1.97 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | GOYPFNAZTPCXGS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccnc(C(F)(F)F)c1F |
| Storage condition | 2-8℃ |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Fluoro-2-(trifluoromethyl)isonicotinic acid |
| 3-Fluoro-2-trifluoromethyl-isonicotinic acid |
| 4-Pyridinecarboxylic acid, 3-fluoro-2-(trifluoromethyl)- |