tert-Butyl 3-(4-chlorophenyl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 3-(4-chlorophenyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 886767-49-3 | Molecular Weight | 296.79200 | |
| Density | 1.155g/cm3 | Boiling Point | 396.5ºC at 760 mmHg | |
| Molecular Formula | C15H21ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | tert-Butyl 3-(4-chlorophenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 396.5ºC at 760 mmHg |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.79200 |
| Flash Point | 193.6ºC |
| Exact Mass | 296.12900 |
| PSA | 41.57000 |
| LogP | 3.48810 |
| Index of Refraction | 1.531 |
| InChIKey | WWWIVVADARKSAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(c2ccc(Cl)cc2)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-(4-chlorophenyl)piperazine-1-carboxylate |