3-Oxo Atorvastatin structure
|
Common Name | 3-Oxo Atorvastatin | ||
|---|---|---|---|---|
| CAS Number | 887196-30-7 | Molecular Weight | 556.62400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H33FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Oxo Atorvastatin3-Oxo Atorvastatin is an impurity of 3-Oxo Atorvastatin. Atorvastatin is an orally active HMG-CoA reductase inhibitor and has the ability to effectively decrease blood lipids[1]. |
| Name | 7-[2-(4-Fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H -pyrrol-1-yl]-5-hydroxy-3-oxoheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Oxo Atorvastatin is an impurity of 3-Oxo Atorvastatin. Atorvastatin is an orally active HMG-CoA reductase inhibitor and has the ability to effectively decrease blood lipids[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C33H33FN2O5 |
|---|---|
| Molecular Weight | 556.62400 |
| Exact Mass | 556.23700 |
| PSA | 112.12000 |
| LogP | 6.90580 |
| InChIKey | JVFCMPKBFPIOON-AREMUKBSSA-N |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(=O)CC(=O)O |
| 3-oxo atorvastatin |
| 3-oxo 2-phenylsulfonylmethyl cyclopentane carbonitrile |
| Cyclopentanecarbonitrile,3-oxo-2-[(phenylsulfonyl)methyl] |