2-chloro-N-[2-[(hydroxyamino)-phenylmethylidene]-1-benzofuran-3-ylidene]acetamide structure
|
Common Name | 2-chloro-N-[2-[(hydroxyamino)-phenylmethylidene]-1-benzofuran-3-ylidene]acetamide | ||
|---|---|---|---|---|
| CAS Number | 88737-26-2 | Molecular Weight | 328.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-[2-[(hydroxyamino)-phenylmethylidene]-1-benzofuran-3-ylidene]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13ClN2O3 |
|---|---|
| Molecular Weight | 328.75000 |
| Exact Mass | 328.06100 |
| PSA | 70.92000 |
| LogP | 3.37200 |
| InChIKey | HJBAXGHATFSURP-HMMYKYKNSA-N |
| SMILES | O=C(CCl)Nc1c(C(=NO)c2ccccc2)oc2ccccc12 |
|
~63%
2-chloro-N-[2-[... CAS#:88737-26-2 |
| Literature: Gatta, Franco; Settimj, Guido Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1251 - 1254 |
|
~%
2-chloro-N-[2-[... CAS#:88737-26-2 |
| Literature: Gatta, Franco; Settimj, Guido Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1251 - 1254 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetamide,2-chloro-N-[2-[(hydroxyimino)phenylmethyl]-3-benzofuranyl] |
| 2-chloro-N-[(2E)-2-[(hydroxyamino)-phenylmethylidene]-1-benzofuran-3-ylidene]acetamide |