8,8-bis{(E)-[(2-hydroxyphenyl)imino]methyl}-5,5-diisopropyl-3,3-dimethyl-2,2-binaphthalene-1,1,6,6,7,7-hexol structure
|
Common Name | 8,8-bis{(E)-[(2-hydroxyphenyl)imino]methyl}-5,5-diisopropyl-3,3-dimethyl-2,2-binaphthalene-1,1,6,6,7,7-hexol | ||
|---|---|---|---|---|
| CAS Number | 88761-85-7 | Molecular Weight | 700.77600 | |
| Density | 1.48g/cm3 | Boiling Point | 913.1ºC at 760 mmHg | |
| Molecular Formula | C42H40N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 506ºC | |
| Name | (1Z)-7-[(8Z)-1,6-dihydroxy-8-[(2-hydroxyanilino)methylidene]-3-methyl-7-oxo-5-propan-2-ylnaphthalen-2-yl]-3,8-dihydroxy-1-[(2-hydroxyanilino)methylidene]-6-methyl-4-propan-2-ylnaphthalen-2-one |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 913.1ºC at 760 mmHg |
| Molecular Formula | C42H40N2O8 |
| Molecular Weight | 700.77600 |
| Flash Point | 506ºC |
| Exact Mass | 700.27800 |
| PSA | 186.56000 |
| LogP | 9.66960 |
| Index of Refraction | 1.802 |
| InChIKey | BNKCDINDHUDPHA-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(C=Nc3ccccc3O)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=Nc3ccccc3O)c2c1O |
|
~%
8,8-bis{(E)-[(2... CAS#:88761-85-7 |
| Literature: Dechary; Brown Journal of the American Oil Chemists' Society, 1956 , vol. 33, p. 76 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |