S-(2-formyl-6-methoxyphenyl) N,N-dimethylcarbamothioate structure
|
Common Name | S-(2-formyl-6-methoxyphenyl) N,N-dimethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 88791-04-2 | Molecular Weight | 239.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2-formyl-6-methoxyphenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3S |
|---|---|
| Molecular Weight | 239.29100 |
| Exact Mass | 239.06200 |
| PSA | 71.91000 |
| LogP | 2.28140 |
| InChIKey | YPVRHIKRKOSZBR-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=O)c1SC(=O)N(C)C |
|
~93%
S-(2-formyl-6-m... CAS#:88791-04-2 |
| Literature: InterMune, Inc. Patent: US2011/152246 A1, 2011 ; Location in patent: Page/Page column 143-144 ; |
|
~%
S-(2-formyl-6-m... CAS#:88791-04-2 |
| Literature: Rahman, Loay K. A.; Scrowston, Richard M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2973 - 2978 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| S-2-formyl-6-methoxyphenyl N,N-dimethylcarbamothioate |
| S-(2-formyl-6-methoxyphenyl)-NN-dimethylthiocarbamate |
| Carbamothioic acid,dimethyl-,S-(2-formyl-6-methoxyphenyl) ester |
| 2-(N,N-dimethylcarbamoylthio)-3-methoxybenzaldehyde |