(Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon) structure
|
Common Name | (Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon) | ||
|---|---|---|---|---|
| CAS Number | 88848-87-7 | Molecular Weight | 1197.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C61H76N14O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon)(Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon) is a GnRH analog that induces ovulation and/or spawning in farmed fish[1]. |
| Name | (Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon) |
|---|---|
| Synonym | More Synonyms |
| Description | (Des-Gly10,D-Ala6,Pro-NHEt9)-LHRH (salmon) is a GnRH analog that induces ovulation and/or spawning in farmed fish[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C61H76N14O12 |
|---|---|
| Molecular Weight | 1197.34 |
| Exact Mass | 1196.58000 |
| PSA | 382.93000 |
| LogP | 3.60000 |
| InChIKey | DTPOGFHWOZMRIR-BXSMXDOGSA-N |
| SMILES | CCNC(=O)C1CCCN1C(=O)C(CC(C)C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(C)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1 |
| (des-gly10,d-ala6,pro-nhet9)-luteinizing hormone-releasing factor (salmon) |
| (des-gly10,d-ala6,pro-nhet9)-luteinizing hormone-releasing hormone (salmon) |
| (des-gly10,d-ala6,pro-nhet9)-gonadotropin-releasing hormone (salmon) |
| pyr-his-trp-ser-tyr-d-ala-trp-leu-pro-nhet |