1,4-Naphthalenedione,2,3-bis[(4-methylphenyl)thio]- structure
|
Common Name | 1,4-Naphthalenedione,2,3-bis[(4-methylphenyl)thio]- | ||
|---|---|---|---|---|
| CAS Number | 88856-15-9 | Molecular Weight | 402.52900 | |
| Density | 1.33g/cm3 | Boiling Point | 541.7ºC at 760mmHg | |
| Molecular Formula | C24H18O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 2,3-bis[(4-methylphenyl)sulfanyl]naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 541.7ºC at 760mmHg |
| Molecular Formula | C24H18O2S2 |
| Molecular Weight | 402.52900 |
| Flash Point | 225.1ºC |
| Exact Mass | 402.07500 |
| PSA | 84.74000 |
| LogP | 6.47860 |
| Index of Refraction | 1.706 |
| InChIKey | IUCYPRNFKHKSML-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SC2=C(Sc3ccc(C)cc3)C(=O)c3ccccc3C2=O)cc1 |
|
~48%
1,4-Naphthalene... CAS#:88856-15-9 |
| Literature: Errante, Giaccomo; La Motta, Grazia; Lagana, Catarina; Wittebolle, Vierle; Sarciron, Marie-Elisabeth; Barret, Roland European Journal of Medicinal Chemistry, 2006 , vol. 41, # 6 p. 773 - 778 |
|
~67%
1,4-Naphthalene... CAS#:88856-15-9 |
| Literature: Ryu, Chung-Kyu; Ik, Hwa Choi; Jung, Yoon Lee; Seong, Hee Jung Heterocycles, 2005 , vol. 65, # 5 p. 1205 - 1214 |
|
~%
1,4-Naphthalene... CAS#:88856-15-9 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
|
~%
1,4-Naphthalene... CAS#:88856-15-9 |
| Literature: Tjepkema Recueil des Travaux Chimiques des Pays-Bas, 1952 , vol. 71, p. 853,855,856 |
|
~10%
1,4-Naphthalene... CAS#:88856-15-9 |
| Literature: Singh, W. Marjit; Baruah, Jubaraj B. Synthetic Communications, 2009 , vol. 39, # 8 p. 1433 - 1442 |
| 1,4-Naphthalenedione,2,3-bis[(4-methylphenyl)thio] |
| 2,3-bis(4-methylphenylsulfanyl)naphthalene-1,4-dione |
| 2,3-bis-p-tolylsulfanyl-[1,4]naphthoquinone |
| bis-2,3-(4-methylphenyl)sulphanyl-1,4-naphthalenedione |
| 2,3-Bis-p-tolylmercapto-[1,4]naphthochinon |
| 2,3-Bis-(4-Methyl-phenylmercapto)-1,4-naphthochinon |
| bis-2,3-(4-methoxyphenyl)sulphanyl-1,4-naphthalenedione |
| HMS2856F16 |
| 2,3-bis(4-methylphenylthio)-1,4-naphthoquinone |
| 2,3-bis[(4-methylphenyl)sulfanyl]-1,4-dihydronaphthalene-1,4-dione |