ethyl 2-(4-acetamidophenyl)sulfonylacetate structure
|
Common Name | ethyl 2-(4-acetamidophenyl)sulfonylacetate | ||
|---|---|---|---|---|
| CAS Number | 88881-74-7 | Molecular Weight | 285.31600 | |
| Density | 1.313g/cm3 | Boiling Point | 532.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.8ºC | |
| Name | ethyl 2-(4-acetamidophenyl)sulfonylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 532.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.31600 |
| Flash Point | 275.8ºC |
| Exact Mass | 285.06700 |
| PSA | 97.92000 |
| LogP | 2.13560 |
| Index of Refraction | 1.547 |
| InChIKey | PCIPTNIPCSLGLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
ethyl 2-(4-acet... CAS#:88881-74-7 |
| Literature: Journal of the Chemical Society, , p. 566,569,570 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Acetamino-phenylsulfon)-essigsaeure-aethylester |
| (N-acetyl-sulfanilyl)-acetic acid ethyl ester |
| (N-Acetyl-sulfanilyl)-essigsaeure-aethylester |
| ethyl 2-[(4-acetamidobenzene)sulfonyl]acetate |