Ethyl (4-acetamidophenyl)acetate structure
|
Common Name | Ethyl (4-acetamidophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 13475-17-7 | Molecular Weight | 221.252 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 390.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | 78ºC | |
| MSDS | N/A | Flash Point | 190.1±23.2 °C | |
| Name | ethyl 2-(4-acetamidophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.8±25.0 °C at 760 mmHg |
| Melting Point | 78ºC |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.252 |
| Flash Point | 190.1±23.2 °C |
| Exact Mass | 221.105194 |
| PSA | 55.40000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | OOLUNZSKHFNSCD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(NC(C)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~97%
Ethyl (4-acetam... CAS#:13475-17-7 |
| Literature: ARAKIS LTD. Patent: WO2005/84658 A1, 2005 ; Location in patent: Page/Page column 10 ; |
|
~92%
Ethyl (4-acetam... CAS#:13475-17-7 |
| Literature: Nippon Shinyaku Company, Limited; Mitsubishi Chemical Industries Limited Patent: US4720506 A1, 1988 ; |
|
~%
Ethyl (4-acetam... CAS#:13475-17-7 |
| Literature: Chemische Berichte, , vol. 72, p. 839,847 |
|
~%
Ethyl (4-acetam... CAS#:13475-17-7 |
| Literature: Chemische Berichte, , vol. 72, p. 839,847 |
|
~%
Ethyl (4-acetam... CAS#:13475-17-7 |
| Literature: Chemische Berichte, , vol. 72, p. 839,847 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Acetylamino-phenyl)-essigsaeure-aethylester |
| Ethyl 2-(4-acetamidophenyl)acetate |
| Ethyl 4-Acetamidophenylacetate |
| Actarit ethyl ester |
| ethyl 4-acetylaminophenylacetate |
| 4-ACETAMIDOPHENYLACETIC ACID ETHYL ESTER |
| Benzeneacetic acid, 4-(acetylamino)-, ethyl ester |
| Ethyl (4-acetamidophenyl)acetate |
| (4-acetylamino-phenyl)-acetic acid ethyl ester |