N-Desmethyl Sumatriptan structure
|
Common Name | N-Desmethyl Sumatriptan | ||
|---|---|---|---|---|
| CAS Number | 88919-51-1 | Molecular Weight | 281.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-1-[3-[2-(methylamino)ethyl]-1H-indol-5-yl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19N3O2S |
|---|---|
| Molecular Weight | 281.37400 |
| Exact Mass | 281.12000 |
| PSA | 82.37000 |
| LogP | 2.84160 |
| InChIKey | YDTVAJYBEHCVJY-UHFFFAOYSA-N |
| SMILES | CNCCc1c[nH]c2ccc(CS(=O)(=O)NC)cc12 |
|
~83%
N-Desmethyl Sum... CAS#:88919-51-1 |
| Literature: Mittapelli, Vasantha; Ray, Puma Chandra; Chauhan, Yogendra Kumar; Datta, Debashish Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 4 p. 590 - 594 |
|
~%
N-Desmethyl Sum... CAS#:88919-51-1 |
| Literature: Mittapelli, Vasantha; Ray, Puma Chandra; Chauhan, Yogendra Kumar; Datta, Debashish Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 4 p. 590 - 594 |
|
~%
N-Desmethyl Sum... CAS#:88919-51-1 |
| Literature: Waterhouse, Ian; Cable, Karl M.; Fellows, Ian; Wipperman, Mark D.; Sutherland, Derek R. Journal of Labelled Compounds and Radiopharmaceuticals, 1996 , vol. 38, # 11 p. 1021 - 1030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-methyl-3-[(2-methylamino)ethyl]-1H-indole-5-methanesulphonamide |
| N-Methyl(3-(2-(methylamino)ethyl)-1H-indol-5-yl)methanesulfonamide |
| UNII-6691XA829C |
| N-Desmethyl SumatriptanDiscontinued |
| Sumatriptan EP Impurity B |
| Monodesmethyl sumatriptan |
| Sumatriptan succinate specified impurity B [EP] |
| 3-(2-(methylamino)ethyl)-N-methyl-1H-indole-5-methanesulphonamide |
| 1H-Indole-5-methanesulfonamide,N-methyl-3-(2-(methylamino)ethyl) |
| N-methyl-2-[5-[[(methylamino)sulphonyl]methyl]-1H-indol-3-yl]ethanamine |
| N-Desmethyl Sumatriptan |
| Sumatriptan Impurity 2 |