N-Desmethyl Trifluoperazine Dihydrochloride structure
|
Common Name | N-Desmethyl Trifluoperazine Dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2804-16-2 | Molecular Weight | 466.39100 | |
| Density | 1.253g/cm3 | Boiling Point | 511ºC at 760 mmHg | |
| Molecular Formula | C20H24Cl2F3N3S | Melting Point | 123-125ºC | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 10-(3-piperazin-1-ylpropyl)-2-(trifluoromethyl)phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 511ºC at 760 mmHg |
| Melting Point | 123-125ºC |
| Molecular Formula | C20H24Cl2F3N3S |
| Molecular Weight | 466.39100 |
| Flash Point | 262.8ºC |
| Exact Mass | 465.10200 |
| PSA | 43.81000 |
| LogP | 6.53910 |
| Vapour Pressure | 1.48E-10mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | VYYRFBRPGFAPCM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCN1CCNCC1)c1ccccc1S2 |
| HS Code | 2934300000 |
|---|
|
~71%
N-Desmethyl Tri... CAS#:2804-16-2 |
| Literature: IMMUNE CONTROL, INC. Patent: WO2008/27521 A1, 2008 ; Location in patent: Page/Page column 56 ; |
|
~81%
N-Desmethyl Tri... CAS#:2804-16-2 |
| Literature: Schepartz, Alarma; Cuenoud, Bernard Journal of the American Chemical Society, 1990 , vol. 112, # 8 p. 3247 - 3249 |
|
~%
N-Desmethyl Tri... CAS#:2804-16-2 |
| Literature: Ratouis,R.; Boissier,J.R. Bulletin de la Societe Chimique de France, 1966 , p. 2963 - 2965 |
|
~%
N-Desmethyl Tri... CAS#:2804-16-2 |
| Literature: Anderson,E.L. et al. Arzneimittel Forschung, 1962 , vol. 12, p. 937 - 942 |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-deshydroxy-ethyl-fluphenazine |
| QSS 5 |
| 1-<3-(2-Trifluormethylphenothiazinyl-10)-propyl>piperazin |
| 4-<3-(2-Trifluormethyl-phenothiazinyl-(10))-propyl>-piperazin |
| desmethyltrifluoperazine |
| 10-(3-(1-Piperazinyl)propyl)-2-(trifluoromethyl)-10H-phenothiazine |
| 10-(3-piperazin-1-yl-propyl)-2-trifluoromethyl-10H-phenothiazine |