S-tert-butyl 3-oxohept-6-enethioate structure
|
Common Name | S-tert-butyl 3-oxohept-6-enethioate | ||
|---|---|---|---|---|
| CAS Number | 88939-05-3 | Molecular Weight | 214.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-tert-butyl 3-oxohept-6-enethioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18O2S |
|---|---|
| Molecular Weight | 214.32400 |
| Exact Mass | 214.10300 |
| PSA | 59.44000 |
| LogP | 2.97010 |
| InChIKey | BLVWMMPQEALNRL-UHFFFAOYSA-N |
| SMILES | C=CCCC(=O)CC(=O)SC(C)(C)C |
|
~90%
S-tert-butyl 3-... CAS#:88939-05-3 |
| Literature: Lopez-Alvarado, Pilar; Avendano, Carmen; Menendez, J. Carlos Synthesis, 1998 , # 2 p. 186 - 194 |
|
~69%
S-tert-butyl 3-... CAS#:88939-05-3 |
| Literature: Booth, Paul M.; Fox, Christina, M. J.; Ley, Steve V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 121 - 130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Heptenethioic acid,3-oxo-,S-(1,1-dimethylethyl) ester |