Methyl N-(tert-butoxycarbonyl)-3-iodo-L-alaninate structure
|
Common Name | Methyl N-(tert-butoxycarbonyl)-3-iodo-L-alaninate | ||
|---|---|---|---|---|
| CAS Number | 889670-02-4 | Molecular Weight | 329.132 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 356.5±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H16INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.4±25.1 °C | |
| Name | Methyl 2-((tert-butoxycarbonyl)amino)-3-iodopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.5±32.0 °C at 760 mmHg |
| Molecular Formula | C9H16INO4 |
| Molecular Weight | 329.132 |
| Flash Point | 169.4±25.1 °C |
| Exact Mass | 329.012390 |
| PSA | 64.63000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | UGZBFCCHLUWCQI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CI)NC(=O)OC(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl N-(tert-butoxycarbonyl)-3-iodo-L-alaninate |
| Methyl 3-iodo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-alaninate |
| Methyl (2S)-2-[(tert-butoxycarbonyl)-amino]-3-iodopropanoate |
| L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-iodo-, methyl ester |