O-phenyl N-(2,2-diethoxyethyl)carbamothioate
O-phenyl N-(2,2-diethoxyethyl)carbamothioate structure
|
Common Name | O-phenyl N-(2,2-diethoxyethyl)carbamothioate | ||
|---|---|---|---|---|
| CAS Number | 88976-01-6 | Molecular Weight | 269.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-phenyl N-(2,2-diethoxyethyl)carbamothioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO3S |
|---|---|
| Molecular Weight | 269.36000 |
| Exact Mass | 269.10900 |
| PSA | 78.85000 |
| LogP | 2.75030 |
| InChIKey | OLKFOWNBDUVFNO-UHFFFAOYSA-N |
| SMILES | CCOC(CNC(=S)Oc1ccccc1)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~59%
O-phenyl N-(2,2... CAS#:88976-01-6 |
| Literature: Maeda; Ohsugi; Fujioka; Hirose Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 10 p. 3424 - 3445 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:73120-22-6
CAS#:88976-02-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Carbamothioic acid,(2,2-diethoxyethyl)-,O-phenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 88976-01-6? |
| A: Chinese name of 88976-01-6 is 88976-01-6. |
| Q: What is the InChIKey of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: InChIKey of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is OLKFOWNBDUVFNO-UHFFFAOYSA-N. |
| Q: What English synonyms does O-phenyl N-(2,2-diethoxyethyl)carbamothioate have? |
| A: English synonyms of O-phenyl N-(2,2-diethoxyethyl)carbamothioate: Carbamothioic acid,(2,2-diethoxyethyl)-,O-phenyl ester. |
| Q: What are the upstream materials of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: Related upstream materials(CAS) of O-phenyl N-(2,2-diethoxyethyl)carbamothioate: 13733-17-0;108-95-2. |
| Q: What is the CAS number of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: CAS number of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is 88976-01-6. |
| Q: What is the molecular weight of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: Molecular weight of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is 269.36000. |
| Q: What is the molecular formula of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: Molecular formula of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is C13H19NO3S. |
| Q: What is the English name of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: The English name of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is O-phenyl N-(2,2-diethoxyethyl)carbamothioate. |
| Q: What is the polar surface area (PSA) of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: Polar surface area (PSA) of O-phenyl N-(2,2-diethoxyethyl)carbamothioate is 78.85000. |
| Q: What are the downstream products of O-phenyl N-(2,2-diethoxyethyl)carbamothioate? |
| A: Related downstream products(CAS) of O-phenyl N-(2,2-diethoxyethyl)carbamothioate: 73120-22-6;88976-02-7. |