4,4'-methylenebis[N,N-dimethyl-2-nitroaniline] structure
|
Common Name | 4,4'-methylenebis[N,N-dimethyl-2-nitroaniline] | ||
|---|---|---|---|---|
| CAS Number | 89-09-8 | Molecular Weight | 344.36500 | |
| Density | 1.282g/cm3 | Boiling Point | 526.3ºC at 760 mmHg | |
| Molecular Formula | C17H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.1ºC | |
| Name | 4-[[4-(dimethylamino)-3-nitrophenyl]methyl]-N,N-dimethyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 526.3ºC at 760 mmHg |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.36500 |
| Flash Point | 272.1ºC |
| Exact Mass | 344.14800 |
| PSA | 98.12000 |
| LogP | 4.27220 |
| Index of Refraction | 1.644 |
| InChIKey | MQXGBQVYQQCHSM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(Cc2ccc(N(C)C)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| HS Code | 2921590090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 201-882-1 |
| Aniline,4,4'-methylenebis[N,N-dimethyl-2-nitro-(6CI,8CI) |
| 4,4'-methylenebis(N,N-dimethyl-2-nitroaniline) |
| Benzenamine,4,4'-methylenebis[N,N-dimethyl-2-nitro |
| 3.3'-Dinitro-4.4'-bis-dimethylamino-diphenylmethan |
| bis-(4-dimethylamino-3-nitro-phenyl)-methane |